Difference between revisions of "CPD-24184"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-HEXAPRENYL-6-METHOXY-14-BENZOQUINOL == * common-name: ** 2-methoxy-6-all trans-hexaprenyl-1,4-benzoquinol * smiles: ** cc(c)=cccc(=cccc...")
(Created page with "Category:metabolite == Metabolite CPD-24184 == == Reaction(s) known to consume the compound == * RXN-22206 == Reaction(s) known to produce the compound == == Reaction(...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-HEXAPRENYL-6-METHOXY-14-BENZOQUINOL ==
+
== Metabolite CPD-24184 ==
* common-name:
 
** 2-methoxy-6-all trans-hexaprenyl-1,4-benzoquinol
 
* smiles:
 
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c
 
* inchi-key:
 
** zagwhopypmukok-fricuitqsa-n
 
* molecular-weight:
 
** 548.848
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN3O-54]]
+
* [[RXN-22206]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methoxy-6-all trans-hexaprenyl-1,4-benzoquinol}}
 
{{#set: inchi-key=inchikey=zagwhopypmukok-fricuitqsa-n}}
 
{{#set: molecular-weight=548.848}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-24184

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality