Difference between revisions of "CPD-24184"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-HEXAPRENYL-6-METHOXY-14-BENZOQUINOL == * common-name: ** 2-methoxy-6-all trans-hexaprenyl-1,4-benzoquinol * smiles: ** cc(c)=cccc(=cccc...")
(Created page with "Category:metabolite == Metabolite CPD-18351 == * common-name: ** 1-cis-vaccenoyl-2-palmitoleoyl phosphatidate * smiles: ** ccccccc=ccccccccccc(occ(oc(=o)cccccccc=ccccccc)c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-HEXAPRENYL-6-METHOXY-14-BENZOQUINOL ==
+
== Metabolite CPD-18351 ==
 
* common-name:
 
* common-name:
** 2-methoxy-6-all trans-hexaprenyl-1,4-benzoquinol
+
** 1-cis-vaccenoyl-2-palmitoleoyl phosphatidate
 
* smiles:
 
* smiles:
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c
+
** ccccccc=ccccccccccc(occ(oc(=o)cccccccc=ccccccc)cop([o-])(=o)[o-])=o
 
* inchi-key:
 
* inchi-key:
** zagwhopypmukok-fricuitqsa-n
+
** glznxlkbzkjbcj-nafnzuqfsa-l
 
* molecular-weight:
 
* molecular-weight:
** 548.848
+
** 670.905
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN3O-54]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17009]]
 +
* [[RXN-17013]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methoxy-6-all trans-hexaprenyl-1,4-benzoquinol}}
+
{{#set: common-name=1-cis-vaccenoyl-2-palmitoleoyl phosphatidate}}
{{#set: inchi-key=inchikey=zagwhopypmukok-fricuitqsa-n}}
+
{{#set: inchi-key=inchikey=glznxlkbzkjbcj-nafnzuqfsa-l}}
{{#set: molecular-weight=548.848}}
+
{{#set: molecular-weight=670.905}}

Revision as of 15:26, 5 January 2021

Metabolite CPD-18351

  • common-name:
    • 1-cis-vaccenoyl-2-palmitoleoyl phosphatidate
  • smiles:
    • ccccccc=ccccccccccc(occ(oc(=o)cccccccc=ccccccc)cop([o-])(=o)[o-])=o
  • inchi-key:
    • glznxlkbzkjbcj-nafnzuqfsa-l
  • molecular-weight:
    • 670.905

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality