Difference between revisions of "CPD-248"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12400 RXN-12400] == * direction: ** left-to-right * common-name: ** xyloglucan xllg oligosaccha...") |
(Created page with "Category:metabolite == Metabolite CPD-13376 == * common-name: ** xxlg xyloglucan oligosaccharide * smiles: ** c8(c(c(c(c(occ7(oc(oc2(c(o)c(o)c(oc(coc1(c(c(c(co1)o)o)o))2)o...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-13376 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** xyloglucan | + | ** xxlg xyloglucan oligosaccharide |
− | + | * smiles: | |
− | * | + | ** c8(c(c(c(c(occ7(oc(oc2(c(o)c(o)c(oc(coc1(c(c(c(co1)o)o)o))2)oc5(c(o)c(o)c(oc(coc3(c(c(c(co3)o)o)oc4(c(c(c(c(o4)co)o)o)o)))5)oc6(c(o)c(o)c(o)oc(co)6))))c(o)c(o)c(o)7))o8)o)o)o) |
− | + | * inchi-key: | |
− | ** | + | ** ujniquvnfjifmg-ikgyadnmsa-n |
− | + | * molecular-weight: | |
− | + | ** 1225.073 | |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[RXN-12398]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=xxlg xyloglucan oligosaccharide}} | |
− | + | {{#set: inchi-key=inchikey=ujniquvnfjifmg-ikgyadnmsa-n}} | |
− | ** | + | {{#set: molecular-weight=1225.073}} |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | ** | ||
− | == | ||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | {{#set: common-name=xyloglucan | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Revision as of 20:35, 18 December 2020
Contents
Metabolite CPD-13376
- common-name:
- xxlg xyloglucan oligosaccharide
- smiles:
- c8(c(c(c(c(occ7(oc(oc2(c(o)c(o)c(oc(coc1(c(c(c(co1)o)o)o))2)oc5(c(o)c(o)c(oc(coc3(c(c(c(co3)o)o)oc4(c(c(c(c(o4)co)o)o)o)))5)oc6(c(o)c(o)c(o)oc(co)6))))c(o)c(o)c(o)7))o8)o)o)o)
- inchi-key:
- ujniquvnfjifmg-ikgyadnmsa-n
- molecular-weight:
- 1225.073