Difference between revisions of "CPD-253"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ08650 == * transcription-direction: ** positive * right-end-position: ** 15111 * left-end-position: ** 6854 * centisome-position: ** 13.472235...") |
(Created page with "Category:metabolite == Metabolite CPD-253 == * common-name: ** 4,5-seco-dopa * smiles: ** c(=o)c=c(cc([n+])c(=o)[o-])c=c(c([o-])=o)o * inchi-key: ** fnegjfdtwwxqes-qtwonpp...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-253 == |
| − | * | + | * common-name: |
| − | ** | + | ** 4,5-seco-dopa |
| − | + | * smiles: | |
| − | + | ** c(=o)c=c(cc([n+])c(=o)[o-])c=c(c([o-])=o)o | |
| − | * | + | * inchi-key: |
| − | ** | + | ** fnegjfdtwwxqes-qtwonppnsa-m |
| − | + | * molecular-weight: | |
| − | + | ** 228.181 | |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-8460]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=4,5-seco-dopa}} | |
| − | + | {{#set: inchi-key=inchikey=fnegjfdtwwxqes-qtwonppnsa-m}} | |
| − | + | {{#set: molecular-weight=228.181}} | |
| − | |||
| − | * | ||
| − | |||
| − | |||
| − | |||
| − | ** | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * | ||
| − | |||
| − | ** | ||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-253
- common-name:
- 4,5-seco-dopa
- smiles:
- c(=o)c=c(cc([n+])c(=o)[o-])c=c(c([o-])=o)o
- inchi-key:
- fnegjfdtwwxqes-qtwonppnsa-m
- molecular-weight:
- 228.181
