Difference between revisions of "CPD-259"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 13E-11-ALPHA-HYDROXY-915-DIOXOPROST-1 == * common-name: ** (13e)-11-α-hydroxy-9,15-dioxoprost-13-enoate * smiles: ** cccccc(=o)c=cc...")
(Created page with "Category:metabolite == Metabolite CPD-259 == * common-name: ** 4-aminophenol * smiles: ** c1(=cc(=cc=c1n)o) * inchi-key: ** plikawjenqzmha-uhfffaoysa-n * molecular-weight:...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 13E-11-ALPHA-HYDROXY-915-DIOXOPROST-1 ==
+
== Metabolite CPD-259 ==
 
* common-name:
 
* common-name:
** (13e)-11-α-hydroxy-9,15-dioxoprost-13-enoate
+
** 4-aminophenol
 
* smiles:
 
* smiles:
** cccccc(=o)c=cc1(c(o)cc(=o)c(ccccccc(=o)[o-])1)
+
** c1(=cc(=cc=c1n)o)
 
* inchi-key:
 
* inchi-key:
** vxpbdcbtmskckz-xqhnhvhjsa-m
+
** plikawjenqzmha-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 351.462
+
** 109.127
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.1.197-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.1.197-RXN]]
+
* [[AMINOPARATHION-PHOSPHATASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(13e)-11-α-hydroxy-9,15-dioxoprost-13-enoate}}
+
{{#set: common-name=4-aminophenol}}
{{#set: inchi-key=inchikey=vxpbdcbtmskckz-xqhnhvhjsa-m}}
+
{{#set: inchi-key=inchikey=plikawjenqzmha-uhfffaoysa-n}}
{{#set: molecular-weight=351.462}}
+
{{#set: molecular-weight=109.127}}

Latest revision as of 11:18, 18 March 2021

Metabolite CPD-259

  • common-name:
    • 4-aminophenol
  • smiles:
    • c1(=cc(=cc=c1n)o)
  • inchi-key:
    • plikawjenqzmha-uhfffaoysa-n
  • molecular-weight:
    • 109.127

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality