Difference between revisions of "CPD-259"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-548 == * common-name: ** s-formylglutathione * smiles: ** c(nc(=o)c(csc=o)nc(=o)ccc([n+])c(=o)[o-])c(=o)[o-] * inchi-key: ** fhxagoic...") |
(Created page with "Category:metabolite == Metabolite CPD-259 == * common-name: ** 4-aminophenol * smiles: ** c1(=cc(=cc=c1n)o) * inchi-key: ** plikawjenqzmha-uhfffaoysa-n * molecular-weight:...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-259 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-aminophenol |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(=cc(=cc=c1n)o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** plikawjenqzmha-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 109.127 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[AMINOPARATHION-PHOSPHATASE-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-aminophenol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=plikawjenqzmha-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=109.127}} |
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite CPD-259
- common-name:
- 4-aminophenol
- smiles:
- c1(=cc(=cc=c1n)o)
- inchi-key:
- plikawjenqzmha-uhfffaoysa-n
- molecular-weight:
- 109.127
