Difference between revisions of "CPD-259"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Butanoyl-ACPs == * common-name: ** a butanoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9516 * RXN-9648 == Reac...") |
(Created page with "Category:metabolite == Metabolite CPD-548 == * common-name: ** s-formylglutathione * smiles: ** c(nc(=o)c(csc=o)nc(=o)ccc([n+])c(=o)[o-])c(=o)[o-] * inchi-key: ** fhxagoic...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-548 == |
* common-name: | * common-name: | ||
| − | ** | + | ** s-formylglutathione |
| + | * smiles: | ||
| + | ** c(nc(=o)c(csc=o)nc(=o)ccc([n+])c(=o)[o-])c(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** fhxagoicbfgebf-bqbzgakwsa-m | ||
| + | * molecular-weight: | ||
| + | ** 334.323 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-276]] |
| − | * [[RXN | + | * [[S-FORMYLGLUTATHIONE-HYDROLASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-2962]] |
| − | * [[ | + | * [[RXN0-276]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=s-formylglutathione}} |
| + | {{#set: inchi-key=inchikey=fhxagoicbfgebf-bqbzgakwsa-m}} | ||
| + | {{#set: molecular-weight=334.323}} | ||
Revision as of 15:00, 5 January 2021
Contents
Metabolite CPD-548
- common-name:
- s-formylglutathione
- smiles:
- c(nc(=o)c(csc=o)nc(=o)ccc([n+])c(=o)[o-])c(=o)[o-]
- inchi-key:
- fhxagoicbfgebf-bqbzgakwsa-m
- molecular-weight:
- 334.323
