Difference between revisions of "CPD-259"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8078 == * common-name: ** 1-18:3-2-16:2-monogalactosyldiacylglycerol * smiles: ** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))o...")
(Created page with "Category:metabolite == Metabolite AMINO-ACETONE == * common-name: ** aminoacetone * smiles: ** cc(c[n+])=o * inchi-key: ** bcdgqxumwhrqcb-uhfffaoysa-o * molecular-weight:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8078 ==
+
== Metabolite AMINO-ACETONE ==
 
* common-name:
 
* common-name:
** 1-18:3-2-16:2-monogalactosyldiacylglycerol
+
** aminoacetone
 
* smiles:
 
* smiles:
** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=cccccc)=o)=o
+
** cc(c[n+])=o
 
* inchi-key:
 
* inchi-key:
** wsmybuvbfwdmec-sbpcighssa-n
+
** bcdgqxumwhrqcb-uhfffaoysa-o
 
* molecular-weight:
 
* molecular-weight:
** 749.036
+
** 74.102
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8309]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8299]]
+
* [[RXN-14249]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:3-2-16:2-monogalactosyldiacylglycerol}}
+
{{#set: common-name=aminoacetone}}
{{#set: inchi-key=inchikey=wsmybuvbfwdmec-sbpcighssa-n}}
+
{{#set: inchi-key=inchikey=bcdgqxumwhrqcb-uhfffaoysa-o}}
{{#set: molecular-weight=749.036}}
+
{{#set: molecular-weight=74.102}}

Revision as of 13:13, 14 January 2021

Metabolite AMINO-ACETONE

  • common-name:
    • aminoacetone
  • smiles:
    • cc(c[n+])=o
  • inchi-key:
    • bcdgqxumwhrqcb-uhfffaoysa-o
  • molecular-weight:
    • 74.102

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality