Difference between revisions of "CPD-2744"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 13-HYDROPEROXYOCTADECA-911-DIENOATE == * common-name: ** (13s)-hpode * smiles: ** cccccc(c=cc=ccccccccc(=o)[o-])oo * inchi-key: ** jdsrhv...") |
(Created page with "Category:metabolite == Metabolite CPD-2744 == * common-name: ** nicotine-glucuronide * smiles: ** c1(cc[ch]([n+](c)1)c3(c=[n+](c2(c(c(c(c(o2)c([o-])=o)o)o)o))c=cc=3)) * in...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-2744 == |
* common-name: | * common-name: | ||
| − | ** | + | ** nicotine-glucuronide |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(cc[ch]([n+](c)1)c3(c=[n+](c2(c(c(c(c(o2)c([o-])=o)o)o)o))c=cc=3)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** sawaiuljdyflpd-soafeqhcsa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 339.367 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN66-83]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=nicotine-glucuronide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=sawaiuljdyflpd-soafeqhcsa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=339.367}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-2744
- common-name:
- nicotine-glucuronide
- smiles:
- c1(cc[ch]([n+](c)1)c3(c=[n+](c2(c(c(c(c(o2)c([o-])=o)o)o)o))c=cc=3))
- inchi-key:
- sawaiuljdyflpd-soafeqhcsa-o
- molecular-weight:
- 339.367
