Difference between revisions of "CPD-2744"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 13-HYDROPEROXYOCTADECA-911-DIENOATE == * common-name: ** (13s)-hpode * smiles: ** cccccc(c=cc=ccccccccc(=o)[o-])oo * inchi-key: ** jdsrhv...") |
(Created page with "Category:metabolite == Metabolite 3-Oxo-Delta-4-Steroids == * common-name: ** a 3-oxo-δ4-steroid == Reaction(s) known to consume the compound == * 1.3.99.5-RXN *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-Oxo-Delta-4-Steroids == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 3-oxo-δ4-steroid |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[1.3.99.5-RXN]] | ||
| + | * [[RXN-13682]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-13682]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 3-oxo-δ4-steroid}} |
| − | |||
| − | |||
Revision as of 18:57, 14 January 2021
Contents
Metabolite 3-Oxo-Delta-4-Steroids
- common-name:
- a 3-oxo-δ4-steroid
