Difference between revisions of "CPD-2747"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9867 == * common-name: ** 3-(all-trans-decaprenyl)benzene-1,2-diol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=c...")
(Created page with "Category:metabolite == Metabolite CPD-2747 == * common-name: ** cotinine-glucuronide * smiles: ** c1(=o)(cc[ch](n(c)1)c3(c=[n+](c2(c(c(c(c(o2)c([o-])=o)o)o)o))c=cc=3)) * i...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9867 ==
+
== Metabolite CPD-2747 ==
 
* common-name:
 
* common-name:
** 3-(all-trans-decaprenyl)benzene-1,2-diol
+
** cotinine-glucuronide
 
* smiles:
 
* smiles:
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c)c)c)c)c
+
** c1(=o)(cc[ch](n(c)1)c3(c=[n+](c2(c(c(c(c(o2)c([o-])=o)o)o)o))c=cc=3))
 
* inchi-key:
 
* inchi-key:
** caujtfnfoamxrt-xrbhbmlssa-n
+
** xwzczwkugiqpjd-cvrqrifosa-n
 
* molecular-weight:
 
* molecular-weight:
** 791.294
+
** 352.343
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9233]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN66-168]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-(all-trans-decaprenyl)benzene-1,2-diol}}
+
{{#set: common-name=cotinine-glucuronide}}
{{#set: inchi-key=inchikey=caujtfnfoamxrt-xrbhbmlssa-n}}
+
{{#set: inchi-key=inchikey=xwzczwkugiqpjd-cvrqrifosa-n}}
{{#set: molecular-weight=791.294}}
+
{{#set: molecular-weight=352.343}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-2747

  • common-name:
    • cotinine-glucuronide
  • smiles:
    • c1(=o)(cc[ch](n(c)1)c3(c=[n+](c2(c(c(c(c(o2)c([o-])=o)o)o)o))c=cc=3))
  • inchi-key:
    • xwzczwkugiqpjd-cvrqrifosa-n
  • molecular-weight:
    • 352.343

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality