Difference between revisions of "CPD-2747"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=LTAA-RXN LTAA-RXN] == * direction: ** left-to-right * common-name: ** l-allo-threonine aldolase * e...")
(Created page with "Category:metabolite == Metabolite CPD-9867 == * common-name: ** 3-(all-trans-decaprenyl)benzene-1,2-diol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=c...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=LTAA-RXN LTAA-RXN] ==
+
== Metabolite CPD-9867 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** l-allo-threonine aldolase
+
** 3-(all-trans-decaprenyl)benzene-1,2-diol
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/4.1.2.48 ec-4.1.2.48]
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c)c)c)c)c
−
** [http://enzyme.expasy.org/EC/4.1.2.49 ec-4.1.2.49]
+
* inchi-key:
−
== Reaction formula ==
+
** caujtfnfoamxrt-xrbhbmlssa-n
−
* 1 [[L-ALLO-THREONINE]][c] '''=>''' 1 [[ACETALD]][c] '''+''' 1 [[GLY]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 791.294
−
* Gene: [[SJ06446]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
* [[RXN-9233]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ12304]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=3-(all-trans-decaprenyl)benzene-1,2-diol}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: inchi-key=inchikey=caujtfnfoamxrt-xrbhbmlssa-n}}
−
== Pathway(s) ==
+
{{#set: molecular-weight=791.294}}
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=26209 26209]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R06171 R06171]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=l-allo-threonine aldolase}}
 
−
{{#set: ec-number=ec-4.1.2.48|ec-4.1.2.49}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:35, 18 December 2020

Metabolite CPD-9867

  • common-name:
    • 3-(all-trans-decaprenyl)benzene-1,2-diol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c)c)c)c)c
  • inchi-key:
    • caujtfnfoamxrt-xrbhbmlssa-n
  • molecular-weight:
    • 791.294

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-2747&oldid=47600"