Difference between revisions of "CPD-2752"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DUDP == * common-name: ** dudp * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key: ** qhwztvccbmii...")
(Created page with "Category:metabolite == Metabolite L-THREONINE-O-3-PHOSPHATE == * common-name: ** l-threonine 3-o-phosphate * smiles: ** cc(op([o-])([o-])=o)c([n+])c([o-])=o * inchi-key: *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DUDP ==
+
== Metabolite L-THREONINE-O-3-PHOSPHATE ==
 
* common-name:
 
* common-name:
** dudp
+
** l-threonine 3-o-phosphate
 
* smiles:
 
* smiles:
** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2))
+
** cc(op([o-])([o-])=o)c([n+])c([o-])=o
 
* inchi-key:
 
* inchi-key:
** qhwztvccbmiike-shyzeuofsa-k
+
** usrgiujoyoxoqj-gbxijsldsa-l
 
* molecular-weight:
 
* molecular-weight:
** 385.14
+
** 197.084
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ATDUD]]
+
* [[4.1.1.81-RXN]]
* [[ATDUDm]]
 
* [[DUDPKIN-RXN]]
 
* [[RXN-14220]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DUDT]]
 
* [[DUTCP]]
 
* [[DUTUP]]
 
* [[RXN-14219]]
 
* [[RXN0-722]]
 
* [[UDPREDUCT-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dudp}}
+
{{#set: common-name=l-threonine 3-o-phosphate}}
{{#set: inchi-key=inchikey=qhwztvccbmiike-shyzeuofsa-k}}
+
{{#set: inchi-key=inchikey=usrgiujoyoxoqj-gbxijsldsa-l}}
{{#set: molecular-weight=385.14}}
+
{{#set: molecular-weight=197.084}}

Revision as of 11:15, 15 January 2021

Metabolite L-THREONINE-O-3-PHOSPHATE

  • common-name:
    • l-threonine 3-o-phosphate
  • smiles:
    • cc(op([o-])([o-])=o)c([n+])c([o-])=o
  • inchi-key:
    • usrgiujoyoxoqj-gbxijsldsa-l
  • molecular-weight:
    • 197.084

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality