Difference between revisions of "CPD-2752"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ADENOSINE_DIPHOSPHATE_RIBOSE == * common-name: ** adp-d-ribose * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op([o-])(=o)...")
(Created page with "Category:metabolite == Metabolite S-Substituted-L-Cysteines == * common-name: ** an l-cysteine-s-conjugate == Reaction(s) known to consume the compound == * RXN-15582...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ADENOSINE_DIPHOSPHATE_RIBOSE ==
+
== Metabolite S-Substituted-L-Cysteines ==
 
* common-name:
 
* common-name:
** adp-d-ribose
+
** an l-cysteine-s-conjugate
* smiles:
 
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op([o-])(=o)occ4(c(o)c(o)c(o4)o))(=o)[o-]
 
* inchi-key:
 
** srnwougrcwsemx-tyasjmozsa-l
 
* molecular-weight:
 
** 557.303
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ARDP]]
+
* [[RXN-15582]]
* [[RXN0-1441]]
+
* [[RXN-6763]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-13684]]
 +
* [[RXN-6642]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=adp-d-ribose}}
+
{{#set: common-name=an l-cysteine-s-conjugate}}
{{#set: inchi-key=inchikey=srnwougrcwsemx-tyasjmozsa-l}}
 
{{#set: molecular-weight=557.303}}
 

Revision as of 14:55, 5 January 2021

Metabolite S-Substituted-L-Cysteines

  • common-name:
    • an l-cysteine-s-conjugate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality