Difference between revisions of "CPD-277"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-971 == * common-name: ** an α-limit dextrin == Reaction(s) known to consume the compound == == Reaction(s) known to produce th...") |
(Created page with "Category:metabolite == Metabolite CPD-277 == * common-name: ** 3-fumarylpyruvate * smiles: ** c([o-])(=o)c=cc(cc(c([o-])=o)=o)=o * inchi-key: ** azcflhzufanaor-owojbtedsa-...") |
||
| (2 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-277 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-fumarylpyruvate |
| + | * smiles: | ||
| + | ** c([o-])(=o)c=cc(cc(c([o-])=o)=o)=o | ||
| + | * inchi-key: | ||
| + | ** azcflhzufanaor-owojbtedsa-l | ||
| + | * molecular-weight: | ||
| + | ** 184.105 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-10445]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-fumarylpyruvate}} |
| + | {{#set: inchi-key=inchikey=azcflhzufanaor-owojbtedsa-l}} | ||
| + | {{#set: molecular-weight=184.105}} | ||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-277
- common-name:
- 3-fumarylpyruvate
- smiles:
- c([o-])(=o)c=cc(cc(c([o-])=o)=o)=o
- inchi-key:
- azcflhzufanaor-owojbtedsa-l
- molecular-weight:
- 184.105
