Difference between revisions of "CPD-277"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17482 RXN-17482] == * direction: ** left-to-right == Reaction formula == * 1 CPD-18888[c] '...") |
(Created page with "Category:metabolite == Metabolite CPD-277 == * common-name: ** 3-fumarylpyruvate * smiles: ** c([o-])(=o)c=cc(cc(c([o-])=o)=o)=o * inchi-key: ** azcflhzufanaor-owojbtedsa-...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-277 == |
| − | * | + | * common-name: |
| − | ** | + | ** 3-fumarylpyruvate |
| − | + | * smiles: | |
| − | * | + | ** c([o-])(=o)c=cc(cc(c([o-])=o)=o)=o |
| − | == | + | * inchi-key: |
| − | * | + | ** azcflhzufanaor-owojbtedsa-l |
| − | ** | + | * molecular-weight: |
| − | ** | + | ** 184.105 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-10445]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=3-fumarylpyruvate}} | |
| − | == | + | {{#set: inchi-key=inchikey=azcflhzufanaor-owojbtedsa-l}} |
| − | {{#set: | + | {{#set: molecular-weight=184.105}} |
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-277
- common-name:
- 3-fumarylpyruvate
- smiles:
- c([o-])(=o)c=cc(cc(c([o-])=o)=o)=o
- inchi-key:
- azcflhzufanaor-owojbtedsa-l
- molecular-weight:
- 184.105
