Difference between revisions of "CPD-281"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ16950 == * transcription-direction: ** negative * right-end-position: ** 521708 * left-end-position: ** 506485 * centisome-position: ** 74.264336...")
(Created page with "Category:metabolite == Metabolite CPD-281 == * common-name: ** s-(2-methylpropanoyl)-dihydrolipoamide * smiles: ** cc(c(sc(ccccc(n)=o)ccs)=o)c * inchi-key: ** xzukurpvwdtx...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ16950 ==
+
== Metabolite CPD-281 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** s-(2-methylpropanoyl)-dihydrolipoamide
−
* right-end-position:
+
* smiles:
−
** 521708
+
** cc(c(sc(ccccc(n)=o)ccs)=o)c
−
* left-end-position:
+
* inchi-key:
−
** 506485
+
** xzukurpvwdtxge-uhfffaoysa-n
−
* centisome-position:
+
* molecular-weight:
−
** 74.264336   
+
** 277.439
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[DHRT_LPAREN_ibcoa_RPAREN_]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) of unknown directionality ==
−
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
+
{{#set: common-name=s-(2-methylpropanoyl)-dihydrolipoamide}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=xzukurpvwdtxge-uhfffaoysa-n}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=277.439}}
−
* [[F16BDEPHOS-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[SEDOHEPTULOSE-BISPHOSPHATASE-RXN]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[SUGAR-PHOSPHATASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[P185-PWY]]
 
−
** '''11''' reactions found over '''12''' reactions in the full pathway
 
−
* [[PWY66-399]]
 
−
** '''11''' reactions found over '''12''' reactions in the full pathway
 
−
* [[SUCSYN-PWY]]
 
−
** '''6''' reactions found over '''7''' reactions in the full pathway
 
−
* [[CALVIN-PWY]]
 
−
** '''12''' reactions found over '''13''' reactions in the full pathway
 
−
* [[GLUCONEO-PWY]]
 
−
** '''12''' reactions found over '''13''' reactions in the full pathway
 
−
* [[PWY-5484]]
 
−
** '''10''' reactions found over '''11''' reactions in the full pathway
 
−
* [[GLYCOLYSIS]]
 
−
** '''11''' reactions found over '''12''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=521708}}
 
−
{{#set: left-end-position=506485}}
 
−
{{#set: centisome-position=74.264336    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=4}}
 
−
{{#set: nb pathway associated=7}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-281

  • common-name:
    • s-(2-methylpropanoyl)-dihydrolipoamide
  • smiles:
    • cc(c(sc(ccccc(n)=o)ccs)=o)c
  • inchi-key:
    • xzukurpvwdtxge-uhfffaoysa-n
  • molecular-weight:
    • 277.439

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-281&oldid=136671"