Difference between revisions of "CPD-281"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite epoxides == * common-name: ** an epoxide == Reaction(s) known to consume the compound == * 3.3.2.10-RXN == Reaction(s) known to produ...")
(Created page with "Category:metabolite == Metabolite CPD-281 == * common-name: ** s-(2-methylpropanoyl)-dihydrolipoamide * smiles: ** cc(c(sc(ccccc(n)=o)ccs)=o)c * inchi-key: ** xzukurpvwdtx...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite epoxides ==
+
== Metabolite CPD-281 ==
 
* common-name:
 
* common-name:
** an epoxide
+
** s-(2-methylpropanoyl)-dihydrolipoamide
 +
* smiles:
 +
** cc(c(sc(ccccc(n)=o)ccs)=o)c
 +
* inchi-key:
 +
** xzukurpvwdtxge-uhfffaoysa-n
 +
* molecular-weight:
 +
** 277.439
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.3.2.10-RXN]]
+
* [[DHRT_LPAREN_ibcoa_RPAREN_]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.3.2.10-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an epoxide}}
+
{{#set: common-name=s-(2-methylpropanoyl)-dihydrolipoamide}}
 +
{{#set: inchi-key=inchikey=xzukurpvwdtxge-uhfffaoysa-n}}
 +
{{#set: molecular-weight=277.439}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-281

  • common-name:
    • s-(2-methylpropanoyl)-dihydrolipoamide
  • smiles:
    • cc(c(sc(ccccc(n)=o)ccs)=o)c
  • inchi-key:
    • xzukurpvwdtxge-uhfffaoysa-n
  • molecular-weight:
    • 277.439

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality