Difference between revisions of "CPD-286"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDRO-DIOH-BENZOATE == * common-name: ** (2s,3s)-2,3-dihydroxy-2,3-dihydrobenzoate * smiles: ** c([o-])(=o)c1(=cc=cc(c1o)o) * inchi-key...") |
(Created page with "Category:metabolite == Metabolite S-GERANYLGERANYL-PROTEIN == * common-name: ** a [protein]-s-geranylgeranyl-l-cysteine == Reaction(s) known to consume the compound == * [...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite S-GERANYLGERANYL-PROTEIN == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [protein]-s-geranylgeranyl-l-cysteine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-3701]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-3701]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [protein]-s-geranylgeranyl-l-cysteine}} |
| − | |||
| − | |||
Revision as of 11:19, 15 January 2021
Contents
Metabolite S-GERANYLGERANYL-PROTEIN
- common-name:
- a [protein]-s-geranylgeranyl-l-cysteine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [protein]-s-geranylgeranyl-l-cysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
