Difference between revisions of "CPD-286"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDRO-DIOH-BENZOATE == * common-name: ** (2s,3s)-2,3-dihydroxy-2,3-dihydrobenzoate * smiles: ** c([o-])(=o)c1(=cc=cc(c1o)o) * inchi-key...") |
(Created page with "Category:metabolite == Metabolite CPD-286 == * common-name: ** 4,5α-dihydrocortisone * smiles: ** cc34([ch]2([ch]([ch]1(c(c)(c(c(=o)co)(o)cc1)cc(=o)2))cc[ch]3cc(=o)c...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-286 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4,5α-dihydrocortisone |
* smiles: | * smiles: | ||
| − | ** | + | ** cc34([ch]2([ch]([ch]1(c(c)(c(c(=o)co)(o)cc1)cc(=o)2))cc[ch]3cc(=o)cc4)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** yclweyibfolmem-fzpgbcfjsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 362.465 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[CORTISONE-ALPHA-REDUCTASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4,5α-dihydrocortisone}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yclweyibfolmem-fzpgbcfjsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=362.465}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-286
- common-name:
- 4,5α-dihydrocortisone
- smiles:
- cc34([ch]2([ch]([ch]1(c(c)(c(c(=o)co)(o)cc1)cc(=o)2))cc[ch]3cc(=o)cc4))
- inchi-key:
- yclweyibfolmem-fzpgbcfjsa-n
- molecular-weight:
- 362.465
