Difference between revisions of "CPD-286"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17367 == * common-name: ** (3r)-hydroxy-adrenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o...") |
(Created page with "Category:metabolite == Metabolite P3I == * common-name: ** pppi * smiles: ** [o-]p(op(=o)(op([o-])(=o)[o-])[o-])([o-])=o * inchi-key: ** unxrwkveancorm-uhfffaoysa-i * mole...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite P3I == |
* common-name: | * common-name: | ||
| − | ** | + | ** pppi |
* smiles: | * smiles: | ||
| − | ** | + | ** [o-]p(op(=o)(op([o-])(=o)[o-])[o-])([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** unxrwkveancorm-uhfffaoysa-i |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 252.915 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[TRIPHOSPHATASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[4.2.3.12-RXN]] |
| + | * [[BTUR2-RXN]] | ||
| + | * [[COBALADENOSYLTRANS-RXN]] | ||
| + | * [[DGTPTRIPHYDRO-RXN]] | ||
| + | * [[R344-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=pppi}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=unxrwkveancorm-uhfffaoysa-i}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=252.915}} |
Revision as of 13:12, 14 January 2021
Contents
Metabolite P3I
- common-name:
- pppi
- smiles:
- [o-]p(op(=o)(op([o-])(=o)[o-])[o-])([o-])=o
- inchi-key:
- unxrwkveancorm-uhfffaoysa-i
- molecular-weight:
- 252.915
