Difference between revisions of "CPD-294"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite EPOXYSQUALENE == * common-name: ** (3s)-2,3-epoxy-2,3-dihydrosqualene * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)cc[ch]1(c(c)(c)...") |
(Created page with "Category:metabolite == Metabolite CPD-294 == * common-name: ** 2-maleylacetate * smiles: ** c(=cc(=o)[o-])c(=o)cc([o-])=o * inchi-key: ** soxxpqlizipmiz-uphrsurjsa-l * mol...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-294 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-maleylacetate |
* smiles: | * smiles: | ||
| − | ** cc( | + | ** c(=cc(=o)[o-])c(=o)cc([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** soxxpqlizipmiz-uphrsurjsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 156.095 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[CARBOXYMETHYLENEBUTENOLIDASE-RXN]] |
| − | * [[ | + | * [[RXN-9733]] |
| + | * [[RXN-9868]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-maleylacetate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=soxxpqlizipmiz-uphrsurjsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=156.095}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-294
- common-name:
- 2-maleylacetate
- smiles:
- c(=cc(=o)[o-])c(=o)cc([o-])=o
- inchi-key:
- soxxpqlizipmiz-uphrsurjsa-l
- molecular-weight:
- 156.095
