Difference between revisions of "CPD-294"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite pppGp-his-tRNAs == * common-name: ** 5'-triphospho-guanosine-ribonucleotide-[trnahis] == Reaction(s) known to consume the compound == ==...") |
(Created page with "Category:metabolite == Metabolite CPD-294 == * common-name: ** 2-maleylacetate * smiles: ** c(=cc(=o)[o-])c(=o)cc([o-])=o * inchi-key: ** soxxpqlizipmiz-uphrsurjsa-l * mol...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-294 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-maleylacetate |
| + | * smiles: | ||
| + | ** c(=cc(=o)[o-])c(=o)cc([o-])=o | ||
| + | * inchi-key: | ||
| + | ** soxxpqlizipmiz-uphrsurjsa-l | ||
| + | * molecular-weight: | ||
| + | ** 156.095 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[CARBOXYMETHYLENEBUTENOLIDASE-RXN]] |
| − | * [[RXN- | + | * [[RXN-9733]] |
| + | * [[RXN-9868]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-maleylacetate}} |
| + | {{#set: inchi-key=inchikey=soxxpqlizipmiz-uphrsurjsa-l}} | ||
| + | {{#set: molecular-weight=156.095}} | ||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-294
- common-name:
- 2-maleylacetate
- smiles:
- c(=cc(=o)[o-])c(=o)cc([o-])=o
- inchi-key:
- soxxpqlizipmiz-uphrsurjsa-l
- molecular-weight:
- 156.095
