Difference between revisions of "CPD-294"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13682 RXN-13682] == * direction: ** reversible * common-name: ** 3-oxo-5-alpha-steroid 4-dehydr...") |
(Created page with "Category:metabolite == Metabolite CPD-294 == * common-name: ** 2-maleylacetate * smiles: ** c(=cc(=o)[o-])c(=o)cc([o-])=o * inchi-key: ** soxxpqlizipmiz-uphrsurjsa-l * mol...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-294 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** 2-maleylacetate |
− | * | + | * smiles: |
− | ** | + | ** c(=cc(=o)[o-])c(=o)cc([o-])=o |
− | == | + | * inchi-key: |
− | + | ** soxxpqlizipmiz-uphrsurjsa-l | |
− | + | * molecular-weight: | |
− | * | + | ** 156.095 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | ** | + | == Reaction(s) known to produce the compound == |
− | == | + | * [[CARBOXYMETHYLENEBUTENOLIDASE-RXN]] |
− | == | + | * [[RXN-9733]] |
− | * | + | * [[RXN-9868]] |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=2-maleylacetate}} | |
− | {{#set: common-name= | + | {{#set: inchi-key=inchikey=soxxpqlizipmiz-uphrsurjsa-l}} |
− | {{#set: | + | {{#set: molecular-weight=156.095}} |
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-294
- common-name:
- 2-maleylacetate
- smiles:
- c(=cc(=o)[o-])c(=o)cc([o-])=o
- inchi-key:
- soxxpqlizipmiz-uphrsurjsa-l
- molecular-weight:
- 156.095