Difference between revisions of "CPD-294"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-160 == * common-name: ** a phosphatidyl-n-dimethylethanolamine == Reaction(s) known to consume the compound == * RXN4FS-2 == Reac...")
(Created page with "Category:metabolite == Metabolite CPD-294 == * common-name: ** 2-maleylacetate * smiles: ** c(=cc(=o)[o-])c(=o)cc([o-])=o * inchi-key: ** soxxpqlizipmiz-uphrsurjsa-l * mol...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-160 ==
+
== Metabolite CPD-294 ==
 
* common-name:
 
* common-name:
** a phosphatidyl-n-dimethylethanolamine
+
** 2-maleylacetate
 +
* smiles:
 +
** c(=cc(=o)[o-])c(=o)cc([o-])=o
 +
* inchi-key:
 +
** soxxpqlizipmiz-uphrsurjsa-l
 +
* molecular-weight:
 +
** 156.095
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN4FS-2]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.1.1.71-RXN]]
+
* [[CARBOXYMETHYLENEBUTENOLIDASE-RXN]]
 +
* [[RXN-9733]]
 +
* [[RXN-9868]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a phosphatidyl-n-dimethylethanolamine}}
+
{{#set: common-name=2-maleylacetate}}
 +
{{#set: inchi-key=inchikey=soxxpqlizipmiz-uphrsurjsa-l}}
 +
{{#set: molecular-weight=156.095}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-294

  • common-name:
    • 2-maleylacetate
  • smiles:
    • c(=cc(=o)[o-])c(=o)cc([o-])=o
  • inchi-key:
    • soxxpqlizipmiz-uphrsurjsa-l
  • molecular-weight:
    • 156.095

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality