Difference between revisions of "CPD-294"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PYRIDOXINE-5P == * common-name: ** pyridoxine 5'-phosphate * smiles: ** cc1(=nc=c(cop([o-])(=o)[o-])c(=c(o)1)co) * inchi-key: ** whomfkwh...") |
(Created page with "Category:metabolite == Metabolite CPD-160 == * common-name: ** a phosphatidyl-n-dimethylethanolamine == Reaction(s) known to consume the compound == * RXN4FS-2 == Reac...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-160 == |
* common-name: | * common-name: | ||
| − | ** | + | ** a phosphatidyl-n-dimethylethanolamine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN4FS-2]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.1.1.71-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a phosphatidyl-n-dimethylethanolamine}} |
| − | |||
| − | |||
Revision as of 13:12, 14 January 2021
Contents
Metabolite CPD-160
- common-name:
- a phosphatidyl-n-dimethylethanolamine
