Difference between revisions of "CPD-2961"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-pseudouridine-38-40 == * common-name: ** a pseudouridine38-40 in trna == Reaction(s) known to consume the compound == == Reaction(s)...")
(Created page with "Category:metabolite == Metabolite CPD-3569 == * common-name: ** glycyl-l-glutamate * smiles: ** c([n+])c(=o)nc(ccc(=o)[o-])c([o-])=o * inchi-key: ** iefjwdngdzaynz-bypyzuc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite tRNA-pseudouridine-38-40 ==
+
== Metabolite CPD-3569 ==
 
* common-name:
 
* common-name:
** a pseudouridine38-40 in trna
+
** glycyl-l-glutamate
 +
* smiles:
 +
** c([n+])c(=o)nc(ccc(=o)[o-])c([o-])=o
 +
* inchi-key:
 +
** iefjwdngdzaynz-bypyzucnsa-m
 +
* molecular-weight:
 +
** 203.174
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN0-6984]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a pseudouridine38-40 in trna}}
+
{{#set: common-name=glycyl-l-glutamate}}
 +
{{#set: inchi-key=inchikey=iefjwdngdzaynz-bypyzucnsa-m}}
 +
{{#set: molecular-weight=203.174}}

Revision as of 18:58, 14 January 2021

Metabolite CPD-3569

  • common-name:
    • glycyl-l-glutamate
  • smiles:
    • c([n+])c(=o)nc(ccc(=o)[o-])c([o-])=o
  • inchi-key:
    • iefjwdngdzaynz-bypyzucnsa-m
  • molecular-weight:
    • 203.174

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality