Difference between revisions of "CPD-2961"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12221 == * common-name: ** methyl bromide * smiles: ** cbr * inchi-key: ** gzuxjhmpeanegy-uhfffaoysa-n * molecular-weight: ** 94.939...")
(Created page with "Category:metabolite == Metabolite CPD-2961 == * common-name: ** d-gluconate 6-phosphate * smiles: ** c(c(c(c(c(c([o-])=o)o)o)o)o)op([o-])([o-])=o * inchi-key: ** birsgzkfk...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12221 ==
+
== Metabolite CPD-2961 ==
 
* common-name:
 
* common-name:
** methyl bromide
+
** d-gluconate 6-phosphate
 
* smiles:
 
* smiles:
** cbr
+
** c(c(c(c(c(c([o-])=o)o)o)o)o)op([o-])([o-])=o
 
* inchi-key:
 
* inchi-key:
** gzuxjhmpeanegy-uhfffaoysa-n
+
** birsgzkfkxlsjq-sqougzdysa-k
 
* molecular-weight:
 
* molecular-weight:
** 94.939
+
** 273.113
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[6PGLUCONDEHYDROG-RXN]]
 +
* [[PGLUCONDEHYDRAT-RXN]]
 +
* [[RXN-3341]]
 +
* [[RXN-9952]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11268]]
+
* [[6PGLUCONOLACT-RXN]]
 +
* [[GLUCONOKIN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=methyl bromide}}
+
{{#set: common-name=d-gluconate 6-phosphate}}
{{#set: inchi-key=inchikey=gzuxjhmpeanegy-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=birsgzkfkxlsjq-sqougzdysa-k}}
{{#set: molecular-weight=94.939}}
+
{{#set: molecular-weight=273.113}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-2961

  • common-name:
    • d-gluconate 6-phosphate
  • smiles:
    • c(c(c(c(c(c([o-])=o)o)o)o)o)op([o-])([o-])=o
  • inchi-key:
    • birsgzkfkxlsjq-sqougzdysa-k
  • molecular-weight:
    • 273.113

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality