Difference between revisions of "CPD-2961"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11921 RXN-11921] == * direction: ** left-to-right * common-name: ** 3-methylcrotonyl-coa:acetyl...")
(Created page with "Category:metabolite == Metabolite CPD-2961 == * common-name: ** d-gluconate 6-phosphate * smiles: ** c(c(c(c(c(c([o-])=o)o)o)o)o)op([o-])([o-])=o * inchi-key: ** birsgzkfk...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11921 RXN-11921] ==
+
== Metabolite CPD-2961 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 3-methylcrotonyl-coa:acetyl-coa c-acyltransferase
+
** d-gluconate 6-phosphate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.3.1 ec-2.3.1]
+
** c(c(c(c(c(c([o-])=o)o)o)o)o)op([o-])([o-])=o
−
* synonymous:
+
* inchi-key:
−
** 5-methyl-3-oxo-4-hexenoyl-coa thiolase
+
** birsgzkfkxlsjq-sqougzdysa-k
−
== Reaction formula ==
+
* molecular-weight:
−
* 1 [[CO-A]][c] '''+''' 1 [[CPD-12906]][c] '''=>''' 1 [[3-METHYL-CROTONYL-COA]][c] '''+''' 1 [[ACETYL-COA]][c]
+
** 273.113
−
== Gene(s) associated with this reaction  ==
+
== Reaction(s) known to consume the compound ==
−
* Gene: [[SJ09371]]
+
* [[6PGLUCONDEHYDROG-RXN]]
−
** Category: [[orthology]]
+
* [[PGLUCONDEHYDRAT-RXN]]
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-3341]]
−
* Gene: [[SJ21818]]
+
* [[RXN-9952]]
−
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[6PGLUCONOLACT-RXN]]
−
== Pathway(s) ==
+
* [[GLUCONOKIN-RXN]]
−
* [[PWY-6672]], cis-genanyl-CoA degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6672 PWY-6672]
+
== Reaction(s) of unknown directionality ==
−
** '''4''' reactions found over '''9''' reactions in the full pathway
+
{{#set: common-name=d-gluconate 6-phosphate}}
−
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=birsgzkfkxlsjq-sqougzdysa-k}}
−
* category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=273.113}}
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R08095 R08095]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=3-methylcrotonyl-coa:acetyl-coa c-acyltransferase}}
 
−
{{#set: ec-number=ec-2.3.1}}
 
−
{{#set: synonymous=5-methyl-3-oxo-4-hexenoyl-coa thiolase}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_arabidopsis_thaliana|output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-2961

  • common-name:
    • d-gluconate 6-phosphate
  • smiles:
    • c(c(c(c(c(c([o-])=o)o)o)o)o)op([o-])([o-])=o
  • inchi-key:
    • birsgzkfkxlsjq-sqougzdysa-k
  • molecular-weight:
    • 273.113

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-2961&oldid=139390"