Difference between revisions of "CPD-2961"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-pseudouridine-38-40 == * common-name: ** a pseudouridine38-40 in trna == Reaction(s) known to consume the compound == == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite CPD-2961 == * common-name: ** d-gluconate 6-phosphate * smiles: ** c(c(c(c(c(c([o-])=o)o)o)o)o)op([o-])([o-])=o * inchi-key: ** birsgzkfk...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-2961 == |
* common-name: | * common-name: | ||
− | ** | + | ** d-gluconate 6-phosphate |
+ | * smiles: | ||
+ | ** c(c(c(c(c(c([o-])=o)o)o)o)o)op([o-])([o-])=o | ||
+ | * inchi-key: | ||
+ | ** birsgzkfkxlsjq-sqougzdysa-k | ||
+ | * molecular-weight: | ||
+ | ** 273.113 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[6PGLUCONDEHYDROG-RXN]] | ||
+ | * [[PGLUCONDEHYDRAT-RXN]] | ||
+ | * [[RXN-3341]] | ||
+ | * [[RXN-9952]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[6PGLUCONOLACT-RXN]] |
+ | * [[GLUCONOKIN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=d-gluconate 6-phosphate}} |
+ | {{#set: inchi-key=inchikey=birsgzkfkxlsjq-sqougzdysa-k}} | ||
+ | {{#set: molecular-weight=273.113}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-2961
- common-name:
- d-gluconate 6-phosphate
- smiles:
- c(c(c(c(c(c([o-])=o)o)o)o)o)op([o-])([o-])=o
- inchi-key:
- birsgzkfkxlsjq-sqougzdysa-k
- molecular-weight:
- 273.113