Difference between revisions of "CPD-2961"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=METHFth METHFth] == * direction: ** reversible * common-name: ** 5,10-methenyltetrahydrofolate upta...") |
(Created page with "Category:metabolite == Metabolite CPD-2961 == * common-name: ** d-gluconate 6-phosphate * smiles: ** c(c(c(c(c(c([o-])=o)o)o)o)o)op([o-])([o-])=o * inchi-key: ** birsgzkfk...") |
||
| (9 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-2961 == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** d-gluconate 6-phosphate |
| − | + | * smiles: | |
| − | * | + | ** c(c(c(c(c(c([o-])=o)o)o)o)o)op([o-])([o-])=o |
| − | == | + | * inchi-key: |
| − | * | + | ** birsgzkfkxlsjq-sqougzdysa-k |
| − | * | + | * molecular-weight: |
| − | * | + | ** 273.113 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | * [[6PGLUCONDEHYDROG-RXN]] | |
| − | * | + | * [[PGLUCONDEHYDRAT-RXN]] |
| − | == | + | * [[RXN-3341]] |
| − | + | * [[RXN-9952]] | |
| − | {{#set: common-name= | + | == Reaction(s) known to produce the compound == |
| − | {{#set: | + | * [[6PGLUCONOLACT-RXN]] |
| − | + | * [[GLUCONOKIN-RXN]] | |
| − | {{#set: | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=d-gluconate 6-phosphate}} | |
| − | + | {{#set: inchi-key=inchikey=birsgzkfkxlsjq-sqougzdysa-k}} | |
| − | + | {{#set: molecular-weight=273.113}} | |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-2961
- common-name:
- d-gluconate 6-phosphate
- smiles:
- c(c(c(c(c(c([o-])=o)o)o)o)o)op([o-])([o-])=o
- inchi-key:
- birsgzkfkxlsjq-sqougzdysa-k
- molecular-weight:
- 273.113
