Difference between revisions of "CPD-3041"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9242 RXN-9242] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/2....") |
(Created page with "Category:metabolite == Metabolite CPD-3041 == * common-name: ** isoliquiritigenin * smiles: ** c2(c=c(o)c=cc(c=cc(=o)c1(c(=cc(o)=cc=1)o))=2) * inchi-key: ** dxdrhhkmwqzjht...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-3041 == |
| − | * | + | * common-name: |
| − | ** | + | ** isoliquiritigenin |
| − | * | + | * smiles: |
| − | ** | + | ** c2(c=c(o)c=cc(c=cc(=o)c1(c(=cc(o)=cc=1)o))=2) |
| − | = | + | * inchi-key: |
| − | + | ** dxdrhhkmwqzjht-fpygclrlsa-n | |
| − | + | * molecular-weight: | |
| − | + | ** 256.257 | |
| − | + | == Reaction(s) known to consume the compound == | |
| − | * | + | * [[RXN-3221]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN-3142]] |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=isoliquiritigenin}} | |
| − | + | {{#set: inchi-key=inchikey=dxdrhhkmwqzjht-fpygclrlsa-n}} | |
| − | + | {{#set: molecular-weight=256.257}} | |
| − | |||
| − | * | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | ||
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * | ||
| − | == | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-3041
- common-name:
- isoliquiritigenin
- smiles:
- c2(c=c(o)c=cc(c=cc(=o)c1(c(=cc(o)=cc=1)o))=2)
- inchi-key:
- dxdrhhkmwqzjht-fpygclrlsa-n
- molecular-weight:
- 256.257
