Difference between revisions of "CPD-3061"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14430 RXN-14430] == * direction: ** left-to-right * common-name: ** hercynine oxygenase (&gamma...") |
(Created page with "Category:metabolite == Metabolite T2-DECENOYL-COA == * common-name: ** (2e)-dec-2-enoyl-coa * smiles: ** cccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(o...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite T2-DECENOYL-COA == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** (2e)-dec-2-enoyl-coa |
− | * | + | * smiles: |
− | ** | + | ** cccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
− | == | + | * inchi-key: |
− | + | ** mgnbgcrqqfmnbm-yjhhllfwsa-j | |
− | == | + | * molecular-weight: |
− | * | + | ** 915.738 |
− | * | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[ECOAH4h]] |
− | == | + | * [[RXN-13616]] |
− | * [[ | + | * [[RXN-14805]] |
− | + | * [[TRANS-2-ENOYL-COA-REDUCTASE-NAD+-RXN-CPD-10267/NAD//T2-DECENOYL-COA/NADH/PROTON.43.]] | |
− | + | * [[TRANSENOYLCOARED-RXN-CPD-10267/NADP//T2-DECENOYL-COA/NADPH/PROTON.45.]] | |
− | * | + | == Reaction(s) known to produce the compound == |
− | == | + | * [[DIENOYLCOAREDUCT-RXN]] |
− | + | * [[ECOAH4h]] | |
− | + | * [[RXN-13615]] | |
− | + | * [[RXN-14805]] | |
− | {{#set: common-name= | + | == Reaction(s) of unknown directionality == |
− | {{#set: | + | {{#set: common-name=(2e)-dec-2-enoyl-coa}} |
− | {{#set: | + | {{#set: inchi-key=inchikey=mgnbgcrqqfmnbm-yjhhllfwsa-j}} |
− | + | {{#set: molecular-weight=915.738}} | |
− | |||
− | |||
− | |||
− |
Revision as of 20:36, 18 December 2020
Contents
Metabolite T2-DECENOYL-COA
- common-name:
- (2e)-dec-2-enoyl-coa
- smiles:
- cccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- mgnbgcrqqfmnbm-yjhhllfwsa-j
- molecular-weight:
- 915.738
Reaction(s) known to consume the compound
- ECOAH4h
- RXN-13616
- RXN-14805
- TRANS-2-ENOYL-COA-REDUCTASE-NAD+-RXN-CPD-10267/NAD//T2-DECENOYL-COA/NADH/PROTON.43.
- TRANSENOYLCOARED-RXN-CPD-10267/NADP//T2-DECENOYL-COA/NADPH/PROTON.45.