Difference between revisions of "CPD-308"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Holo-LYS2-peptidyl-carrier-protein == * common-name: ** a holo-[lys2 peptidyl-carrier-protein] == Reaction(s) known to consume the compou...")
(Created page with "Category:metabolite == Metabolite CPD-308 == * common-name: ** d-nopaline * smiles: ** c([o-])(=o)ccc([n+]c(c(=o)[o-])cccnc(n)=[n+])c([o-])=o * inchi-key: ** lmkyzbgvkhtlt...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Holo-LYS2-peptidyl-carrier-protein ==
+
== Metabolite CPD-308 ==
 
* common-name:
 
* common-name:
** a holo-[lys2 peptidyl-carrier-protein]
+
** d-nopaline
 +
* smiles:
 +
** c([o-])(=o)ccc([n+]c(c(=o)[o-])cccnc(n)=[n+])c([o-])=o
 +
* inchi-key:
 +
** lmkyzbgvkhtltn-nkwvepmbsa-m
 +
* molecular-weight:
 +
** 303.294
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16759]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16759]]
+
* [[1.5.1.19-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a holo-[lys2 peptidyl-carrier-protein]}}
+
{{#set: common-name=d-nopaline}}
 +
{{#set: inchi-key=inchikey=lmkyzbgvkhtltn-nkwvepmbsa-m}}
 +
{{#set: molecular-weight=303.294}}

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-308

  • common-name:
    • d-nopaline
  • smiles:
    • c([o-])(=o)ccc([n+]c(c(=o)[o-])cccnc(n)=[n+])c([o-])=o
  • inchi-key:
    • lmkyzbgvkhtltn-nkwvepmbsa-m
  • molecular-weight:
    • 303.294

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality