Difference between revisions of "CPD-308"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ07002 == * transcription-direction: ** positive * right-end-position: ** 15026 * left-end-position: ** 10665 * centisome-position: ** 14.804480...")
(Created page with "Category:metabolite == Metabolite CPD-308 == * common-name: ** d-nopaline * smiles: ** c([o-])(=o)ccc([n+]c(c(=o)[o-])cccnc(n)=[n+])c([o-])=o * inchi-key: ** lmkyzbgvkhtlt...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ07002 ==
+
== Metabolite CPD-308 ==
* transcription-direction:
+
* common-name:
** positive
+
** d-nopaline
* right-end-position:
+
* smiles:
** 15026
+
** c([o-])(=o)ccc([n+]c(c(=o)[o-])cccnc(n)=[n+])c([o-])=o
* left-end-position:
+
* inchi-key:
** 10665
+
** lmkyzbgvkhtltn-nkwvepmbsa-m
* centisome-position:
+
* molecular-weight:
** 14.804480   
+
** 303.294
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) associated ==
+
* [[1.5.1.19-RXN]]
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=d-nopaline}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=lmkyzbgvkhtltn-nkwvepmbsa-m}}
{{#set: transcription-direction=positive}}
+
{{#set: molecular-weight=303.294}}
{{#set: right-end-position=15026}}
 
{{#set: left-end-position=10665}}
 
{{#set: centisome-position=14.804480    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-308

  • common-name:
    • d-nopaline
  • smiles:
    • c([o-])(=o)ccc([n+]c(c(=o)[o-])cccnc(n)=[n+])c([o-])=o
  • inchi-key:
    • lmkyzbgvkhtltn-nkwvepmbsa-m
  • molecular-weight:
    • 303.294

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality