Difference between revisions of "CPD-308"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Glucuronosylated-Glucuronoside-Acceptors == * common-name: ** a glucuronated glucosyluronate acceptor == Reaction(s) known to consume the...") |
(Created page with "Category:metabolite == Metabolite CPD-308 == * common-name: ** d-nopaline * smiles: ** c([o-])(=o)ccc([n+]c(c(=o)[o-])cccnc(n)=[n+])c([o-])=o * inchi-key: ** lmkyzbgvkhtlt...") |
||
(5 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-308 == |
* common-name: | * common-name: | ||
− | ** | + | ** d-nopaline |
+ | * smiles: | ||
+ | ** c([o-])(=o)ccc([n+]c(c(=o)[o-])cccnc(n)=[n+])c([o-])=o | ||
+ | * inchi-key: | ||
+ | ** lmkyzbgvkhtltn-nkwvepmbsa-m | ||
+ | * molecular-weight: | ||
+ | ** 303.294 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[1.5.1.19-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=d-nopaline}} |
+ | {{#set: inchi-key=inchikey=lmkyzbgvkhtltn-nkwvepmbsa-m}} | ||
+ | {{#set: molecular-weight=303.294}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-308
- common-name:
- d-nopaline
- smiles:
- c([o-])(=o)ccc([n+]c(c(=o)[o-])cccnc(n)=[n+])c([o-])=o
- inchi-key:
- lmkyzbgvkhtltn-nkwvepmbsa-m
- molecular-weight:
- 303.294