Difference between revisions of "CPD-308"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ07051 == * transcription-direction: ** positive * right-end-position: ** 48053 * left-end-position: ** 40644 * centisome-position: ** 56.974644...") |
(Created page with "Category:metabolite == Metabolite CPD-506 == * common-name: ** d-myo-inositol (1,3,4,5)-tetrakisphosphate * smiles: ** c1(o)(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-506 == |
− | * | + | * common-name: |
− | ** | + | ** d-myo-inositol (1,3,4,5)-tetrakisphosphate |
− | + | * smiles: | |
− | + | ** c1(o)(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)c(op([o-])([o-])=o)1) | |
− | + | * inchi-key: | |
− | * | + | ** cipfcgzlfxvxbg-cnwjwelysa-f |
− | + | * molecular-weight: | |
− | ** | + | ** 492.013 |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[RXN-7184]] | |
− | = | + | * [[RXN-8730]] |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[2.7.1.127-RXN]] |
− | *** | + | * [[2.7.1.139-RXN]] |
− | * [[RXN- | + | == Reaction(s) of unknown directionality == |
− | * | + | {{#set: common-name=d-myo-inositol (1,3,4,5)-tetrakisphosphate}} |
− | + | {{#set: inchi-key=inchikey=cipfcgzlfxvxbg-cnwjwelysa-f}} | |
− | == | + | {{#set: molecular-weight=492.013}} |
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 20:31, 18 December 2020
Contents
Metabolite CPD-506
- common-name:
- d-myo-inositol (1,3,4,5)-tetrakisphosphate
- smiles:
- c1(o)(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)c(op([o-])([o-])=o)1)
- inchi-key:
- cipfcgzlfxvxbg-cnwjwelysa-f
- molecular-weight:
- 492.013