Difference between revisions of "CPD-308"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-506 == * common-name: ** d-myo-inositol (1,3,4,5)-tetrakisphosphate * smiles: ** c1(o)(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)...")
(Created page with "Category:metabolite == Metabolite Glucuronosylated-Glucuronoside-Acceptors == * common-name: ** a glucuronated glucosyluronate acceptor == Reaction(s) known to consume the...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-506 ==
+
== Metabolite Glucuronosylated-Glucuronoside-Acceptors ==
 
* common-name:
 
* common-name:
** d-myo-inositol (1,3,4,5)-tetrakisphosphate
+
** a glucuronated glucosyluronate acceptor
* smiles:
 
** c1(o)(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)c(op([o-])([o-])=o)1)
 
* inchi-key:
 
** cipfcgzlfxvxbg-cnwjwelysa-f
 
* molecular-weight:
 
** 492.013
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7184]]
 
* [[RXN-8730]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.1.127-RXN]]
+
* [[UDP-GLUCURONOSYLTRANSFERASE-RXN]]
* [[2.7.1.139-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-myo-inositol (1,3,4,5)-tetrakisphosphate}}
+
{{#set: common-name=a glucuronated glucosyluronate acceptor}}
{{#set: inchi-key=inchikey=cipfcgzlfxvxbg-cnwjwelysa-f}}
 
{{#set: molecular-weight=492.013}}
 

Revision as of 14:55, 5 January 2021

Metabolite Glucuronosylated-Glucuronoside-Acceptors

  • common-name:
    • a glucuronated glucosyluronate acceptor

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality