Difference between revisions of "CPD-308"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ07051 == * transcription-direction: ** positive * right-end-position: ** 48053 * left-end-position: ** 40644 * centisome-position: ** 56.974644...") |
(Created page with "Category:metabolite == Metabolite CPD-308 == * common-name: ** d-nopaline * smiles: ** c([o-])(=o)ccc([n+]c(c(=o)[o-])cccnc(n)=[n+])c([o-])=o * inchi-key: ** lmkyzbgvkhtlt...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-308 == |
− | * | + | * common-name: |
− | ** | + | ** d-nopaline |
− | * | + | * smiles: |
− | ** | + | ** c([o-])(=o)ccc([n+]c(c(=o)[o-])cccnc(n)=[n+])c([o-])=o |
− | * | + | * inchi-key: |
− | ** | + | ** lmkyzbgvkhtltn-nkwvepmbsa-m |
− | * | + | * molecular-weight: |
− | ** | + | ** 303.294 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | == Reaction(s) | + | * [[1.5.1.19-RXN]] |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=d-nopaline}} | |
− | + | {{#set: inchi-key=inchikey=lmkyzbgvkhtltn-nkwvepmbsa-m}} | |
− | + | {{#set: molecular-weight=303.294}} | |
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-308
- common-name:
- d-nopaline
- smiles:
- c([o-])(=o)ccc([n+]c(c(=o)[o-])cccnc(n)=[n+])c([o-])=o
- inchi-key:
- lmkyzbgvkhtltn-nkwvepmbsa-m
- molecular-weight:
- 303.294