Difference between revisions of "CPD-309"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18761 == * common-name: ** coniferyl alcohol radical * smiles: ** coc1(=cc(=ccco)c=cc(=o)1) * inchi-key: ** orajwsykrgvtdp-uhfffaoysa...")
(Created page with "Category:metabolite == Metabolite DUMP == * common-name: ** dump * smiles: ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key: ** jsrljpsbldheio-shyzeuofs...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-18761 ==
+
== Metabolite DUMP ==
 
* common-name:
 
* common-name:
** coniferyl alcohol radical
+
** dump
 
* smiles:
 
* smiles:
** coc1(=cc(=ccco)c=cc(=o)1)
+
** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2))
 
* inchi-key:
 
* inchi-key:
** orajwsykrgvtdp-uhfffaoysa-n
+
** jsrljpsbldheio-shyzeuofsa-l
 
* molecular-weight:
 
* molecular-weight:
** 179.195
+
** 306.168
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[MDUMT]]
 +
* [[RXN-14143]]
 +
* [[THYMIDYLATESYN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17351]]
+
* [[DCMP-DEAMINASE-RXN]]
* [[RXN-17352]]
+
* [[DUTNH]]
 +
* [[DUTP-PYROP-RXN]]
 +
* [[MDUMT]]
 +
* [[RXN-14199]]
 +
* [[RXN-14220]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=coniferyl alcohol radical}}
+
{{#set: common-name=dump}}
{{#set: inchi-key=inchikey=orajwsykrgvtdp-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=jsrljpsbldheio-shyzeuofsa-l}}
{{#set: molecular-weight=179.195}}
+
{{#set: molecular-weight=306.168}}

Revision as of 08:25, 15 March 2021

Metabolite DUMP

  • common-name:
    • dump
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2))
  • inchi-key:
    • jsrljpsbldheio-shyzeuofsa-l
  • molecular-weight:
    • 306.168

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality