Difference between revisions of "CPD-31"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite THZ-P == * common-name: ** 4-methyl-5-(2-phosphooxyethyl)thiazole * smiles: ** cc1(n=csc(ccop([o-])(=o)[o-])=1) * inchi-key: ** ocymerzcm...")
(Created page with "Category:metabolite == Metabolite BUTYRYL-COA == * common-name: ** butanoyl-coa * smiles: ** cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite THZ-P ==
+
== Metabolite BUTYRYL-COA ==
 
* common-name:
 
* common-name:
** 4-methyl-5-(2-phosphooxyethyl)thiazole
+
** butanoyl-coa
 
* smiles:
 
* smiles:
** cc1(n=csc(ccop([o-])(=o)[o-])=1)
+
** cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** ocymerzcmyjqqo-uhfffaoysa-l
+
** crfngmnykdxrtn-hdrjhvaisa-j
 
* molecular-weight:
 
* molecular-weight:
** 221.167
+
** 833.593
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[THI-P-SYN-RXN]]
+
* [[ACACT2h]]
 +
* [[ACOA40OR]]
 +
* [[ACOAD1f]]
 +
* [[RXN-12565]]
 +
* [[RXN-13029]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[THIAZOLSYN3-RXN]]
+
* [[ACOAD1f]]
 +
* [[ACOAR1h]]
 +
* [[BUTYRYL-COA-DEHYDROGENASE-RXN]]
 +
* [[RXN-12558]]
 +
* [[RXN-13029]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-methyl-5-(2-phosphooxyethyl)thiazole}}
+
{{#set: common-name=butanoyl-coa}}
{{#set: inchi-key=inchikey=ocymerzcmyjqqo-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=crfngmnykdxrtn-hdrjhvaisa-j}}
{{#set: molecular-weight=221.167}}
+
{{#set: molecular-weight=833.593}}

Revision as of 18:58, 14 January 2021

Metabolite BUTYRYL-COA

  • common-name:
    • butanoyl-coa
  • smiles:
    • cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • crfngmnykdxrtn-hdrjhvaisa-j
  • molecular-weight:
    • 833.593

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality