Difference between revisions of "CPD-31"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-31 == * common-name: ** (r)-citramalate * smiles: ** cc(o)(c(=o)[o-])cc(=o)[o-] * inchi-key: ** xftrtwqbiomvpk-rxmqykedsa-l * molecul...") |
(Created page with "Category:metabolite == Metabolite CPD-596 == * common-name: ** n6,n6-dimethyl-l-arginine * smiles: ** cn(c(=[n+])ncccc([n+])c(=o)[o-])c * inchi-key: ** ydgmgexadbmomj-lurj...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-596 == |
* common-name: | * common-name: | ||
| − | ** | + | ** n6,n6-dimethyl-l-arginine |
* smiles: | * smiles: | ||
| − | ** | + | ** cn(c(=[n+])ncccc([n+])c(=o)[o-])c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ydgmgexadbmomj-lurjtmiesa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 203.264 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[DIMETHYLARGININASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n6,n6-dimethyl-l-arginine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ydgmgexadbmomj-lurjtmiesa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=203.264}} |
Revision as of 08:30, 15 March 2021
Contents
Metabolite CPD-596
- common-name:
- n6,n6-dimethyl-l-arginine
- smiles:
- cn(c(=[n+])ncccc([n+])c(=o)[o-])c
- inchi-key:
- ydgmgexadbmomj-lurjtmiesa-o
- molecular-weight:
- 203.264
