Difference between revisions of "CPD-31"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-31 == * common-name: ** (r)-citramalate * smiles: ** cc(o)(c(=o)[o-])cc(=o)[o-] * inchi-key: ** xftrtwqbiomvpk-rxmqykedsa-l * molecul...") |
(Created page with "Category:metabolite == Metabolite CPD-31 == * common-name: ** (r)-citramalate * smiles: ** cc(o)(c(=o)[o-])cc(=o)[o-] * inchi-key: ** xftrtwqbiomvpk-rxmqykedsa-l * molecul...") |
| (One intermediate revision by the same user not shown) | |
(No difference)
| |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-31
- common-name:
- (r)-citramalate
- smiles:
- cc(o)(c(=o)[o-])cc(=o)[o-]
- inchi-key:
- xftrtwqbiomvpk-rxmqykedsa-l
- molecular-weight:
- 146.099
