Difference between revisions of "CPD-31"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SULFATE == * common-name: ** sulfate * smiles: ** o=s(=o)([o-])[o-] * inchi-key: ** qaowncqodcnurd-uhfffaoysa-l * molecular-weight: ** 96...") |
(Created page with "Category:metabolite == Metabolite CPD-31 == * common-name: ** (r)-citramalate * smiles: ** cc(o)(c(=o)[o-])cc(=o)[o-] * inchi-key: ** xftrtwqbiomvpk-rxmqykedsa-l * molecul...") |
||
| (6 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-31 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (r)-citramalate |
* smiles: | * smiles: | ||
| − | ** o | + | ** cc(o)(c(=o)[o-])cc(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xftrtwqbiomvpk-rxmqykedsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 146.099 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[R-2-METHYLMALATE-DEHYDRATASE-RXN]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[R-2-METHYLMALATE-DEHYDRATASE-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(r)-citramalate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xftrtwqbiomvpk-rxmqykedsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=146.099}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-31
- common-name:
- (r)-citramalate
- smiles:
- cc(o)(c(=o)[o-])cc(=o)[o-]
- inchi-key:
- xftrtwqbiomvpk-rxmqykedsa-l
- molecular-weight:
- 146.099
