Difference between revisions of "CPD-315"

Revision as of 18:59, 14 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite 1-Alkyl-2-acyl-3D-galactosyl-sn-glycerol ==
+== Metabolite CH33ADO ==
 * common-name:
-** a 1-o-alkyl-2-o-acyl-3-o-&beta;-d-galactosyl-sn-glycerol
+** 5'-deoxyadenosine
+* smiles:
+** cc1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23)))
+* inchi-key:
+** xgyimtfotbmpfp-kqynxxcusa-n
+* molecular-weight:
+** 251.244
 == Reaction(s) known to consume the compound ==
-* [[RXN-17203]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-17203]]
+* [[2.8.1.6-RXN]]
+* [[HEMN-RXN]]
+* [[PYRIMSYN1-RXN]]
+* [[RXN-11319]]
+* [[RXN-11586]]
+* [[RXN-14480]]
+* [[RXN-14950]]
+* [[RXN-14957]]
+* [[RXN-14959]]
+* [[RXN-17472]]
+* [[RXN-17473]]
+* [[RXN-8340]]
+* [[RXN0-5063]]
+* [[RXN0-949]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=a 1-o-alkyl-2-o-acyl-3-o-&beta;-d-galactosyl-sn-glycerol}}
+{{#set: common-name=5'-deoxyadenosine}}
+{{#set: inchi-key=inchikey=xgyimtfotbmpfp-kqynxxcusa-n}}
+{{#set: molecular-weight=251.244}}