Difference between revisions of "CPD-315"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CH33ADO == * common-name: ** 5'-deoxyadenosine * smiles: ** cc1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23))) * inchi-key: ** xgyimtfotbmpfp-kqy...") |
(Created page with "Category:metabolite == Metabolite ALPHA-METHYL-5-ALPHA-ERGOSTA == * common-name: ** 4α-methyl-5α-ergosta-8,14,24(28)-trien-3β-ol * smiles: ** cc(c)c(=c)cc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ALPHA-METHYL-5-ALPHA-ERGOSTA == |
* common-name: | * common-name: | ||
| − | ** 5 | + | ** 4α-methyl-5α-ergosta-8,14,24(28)-trien-3β-ol |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)c(=c)ccc(c)[ch]3(cc=c4(c2(cc[ch]1(c(c)c(o)ccc(c)1c=2ccc(c)34)))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** hlawvowadpnagn-bahzufoisa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 410.682 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-4144]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[1.14.13.70-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=5 | + | {{#set: common-name=4α-methyl-5α-ergosta-8,14,24(28)-trien-3β-ol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hlawvowadpnagn-bahzufoisa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=410.682}} |
Revision as of 11:19, 15 January 2021
Contents
Metabolite ALPHA-METHYL-5-ALPHA-ERGOSTA
- common-name:
- 4α-methyl-5α-ergosta-8,14,24(28)-trien-3β-ol
- smiles:
- cc(c)c(=c)ccc(c)[ch]3(cc=c4(c2(cc[ch]1(c(c)c(o)ccc(c)1c=2ccc(c)34))))
- inchi-key:
- hlawvowadpnagn-bahzufoisa-n
- molecular-weight:
- 410.682
