Difference between revisions of "CPD-316"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-2961 == * common-name: ** d-gluconate 6-phosphate * smiles: ** c(c(c(c(c(c([o-])=o)o)o)o)o)op([o-])([o-])=o * inchi-key: ** birsgzkfk...") |
(Created page with "Category:metabolite == Metabolite CPD-316 == * common-name: ** reduced riboflavin * smiles: ** cc1(=c(c=c2(c(=c1)nc3(c(n2cc(o)c(o)c(o)co)=nc(nc3=o)=o)))c) * inchi-key: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-316 == |
* common-name: | * common-name: | ||
| − | ** | + | ** reduced riboflavin |
* smiles: | * smiles: | ||
| − | ** c(c(c(c( | + | ** cc1(=c(c=c2(c(=c1)nc3(c(n2cc(o)c(o)c(o)co)=nc(nc3=o)=o)))c) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** utkdoucgqvljin-pigzvrmjsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 378.384 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[NADPH-DEHYDROGENASE-FLAVIN-RXN]] |
| − | * [[ | + | * [[RXN-12445]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=reduced riboflavin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=utkdoucgqvljin-pigzvrmjsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=378.384}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-316
- common-name:
- reduced riboflavin
- smiles:
- cc1(=c(c=c2(c(=c1)nc3(c(n2cc(o)c(o)c(o)co)=nc(nc3=o)=o)))c)
- inchi-key:
- utkdoucgqvljin-pigzvrmjsa-n
- molecular-weight:
- 378.384
