Difference between revisions of "CPD-3188"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13755 == * common-name: ** 5-hydroxy-3-[(3as,4s,5r,7as)-7a-methyl-1,5-dioxo-octahydro-1h-inden-4-yl]propanoyl-coa * smiles: ** cc(c)(...") |
(Created page with "Category:metabolite == Metabolite PHOSPHORIBOSYL-CARBOXY-AMINOIMIDAZOLE == * common-name: ** 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxylate * smiles: ** c(op([o-])...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite PHOSPHORIBOSYL-CARBOXY-AMINOIMIDAZOLE == |
* common-name: | * common-name: | ||
− | ** 5- | + | ** 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxylate |
* smiles: | * smiles: | ||
− | ** | + | ** c(op([o-])([o-])=o)c2(c(o)c(o)c(n1(c=nc(c([o-])=o)=c(n)1))o2) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** xfvulmdjzxymsg-ziyngmlesa-k |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 336.174 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[AIRCARBOXY-RXN]] |
+ | * [[SAICARSYN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[AIRCARBOXY-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=5- | + | {{#set: common-name=5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxylate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xfvulmdjzxymsg-ziyngmlesa-k}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=336.174}} |
Revision as of 18:58, 14 January 2021
Contents
Metabolite PHOSPHORIBOSYL-CARBOXY-AMINOIMIDAZOLE
- common-name:
- 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxylate
- smiles:
- c(op([o-])([o-])=o)c2(c(o)c(o)c(n1(c=nc(c([o-])=o)=c(n)1))o2)
- inchi-key:
- xfvulmdjzxymsg-ziyngmlesa-k
- molecular-weight:
- 336.174