Difference between revisions of "CPD-3188"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHOSPHORIBOSYL-CARBOXY-AMINOIMIDAZOLE == * common-name: ** 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxylate * smiles: ** c(op([o-])...")
(Created page with "Category:metabolite == Metabolite CPD66-43 == * common-name: ** 2-palmitoylglycerol * smiles: ** cccccccccccccccc(=o)oc(co)co * inchi-key: ** bbnyclarevxosg-uhfffaoysa-n *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PHOSPHORIBOSYL-CARBOXY-AMINOIMIDAZOLE ==
+
== Metabolite CPD66-43 ==
 
* common-name:
 
* common-name:
** 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxylate
+
** 2-palmitoylglycerol
 
* smiles:
 
* smiles:
** c(op([o-])([o-])=o)c2(c(o)c(o)c(n1(c=nc(c([o-])=o)=c(n)1))o2)
+
** cccccccccccccccc(=o)oc(co)co
 
* inchi-key:
 
* inchi-key:
** xfvulmdjzxymsg-ziyngmlesa-k
+
** bbnyclarevxosg-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 336.174
+
** 330.507
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[AIRCARBOXY-RXN]]
+
* [[2-ACYLGLYCEROL-O-ACYLTRANSFERASE-RXN-CPD66-43/STEAROYL-COA//CPD-17271/CO-A.38.]]
* [[SAICARSYN-RXN]]
+
* [[RXN-7952-CPD66-43/WATER//GLYCEROL/PALMITATE/PROTON.42.]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[AIRCARBOXY-RXN]]
+
* [[2-ACYLGLYCEROL-O-ACYLTRANSFERASE-RXN-CPD66-43/STEAROYL-COA//CPD-17271/CO-A.38.]]
 +
* [[RXN-1602-CPD-17271/WATER//CPD66-43/STEARIC_ACID/PROTON.46.]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxylate}}
+
{{#set: common-name=2-palmitoylglycerol}}
{{#set: inchi-key=inchikey=xfvulmdjzxymsg-ziyngmlesa-k}}
+
{{#set: inchi-key=inchikey=bbnyclarevxosg-uhfffaoysa-n}}
{{#set: molecular-weight=336.174}}
+
{{#set: molecular-weight=330.507}}

Revision as of 11:18, 15 January 2021

Metabolite CPD66-43

  • common-name:
    • 2-palmitoylglycerol
  • smiles:
    • cccccccccccccccc(=o)oc(co)co
  • inchi-key:
    • bbnyclarevxosg-uhfffaoysa-n
  • molecular-weight:
    • 330.507

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality