Difference between revisions of "CPD-3188"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHOSPHORIBOSYL-CARBOXY-AMINOIMIDAZOLE == * common-name: ** 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxylate * smiles: ** c(op([o-])...")
(Created page with "Category:metabolite == Metabolite CPD-3188 == * common-name: ** n'-hydroxymethyl-norcotinine * smiles: ** c1(=o)(cc[ch](n(co)1)c2(c=nc=cc=2)) * inchi-key: ** gqufobhepvfqm...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PHOSPHORIBOSYL-CARBOXY-AMINOIMIDAZOLE ==
+
== Metabolite CPD-3188 ==
 
* common-name:
 
* common-name:
** 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxylate
+
** n'-hydroxymethyl-norcotinine
 
* smiles:
 
* smiles:
** c(op([o-])([o-])=o)c2(c(o)c(o)c(n1(c=nc(c([o-])=o)=c(n)1))o2)
+
** c1(=o)(cc[ch](n(co)1)c2(c=nc=cc=2))
 
* inchi-key:
 
* inchi-key:
** xfvulmdjzxymsg-ziyngmlesa-k
+
** gqufobhepvfqmd-vifpvbqesa-n
 
* molecular-weight:
 
* molecular-weight:
** 336.174
+
** 192.217
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[AIRCARBOXY-RXN]]
 
* [[SAICARSYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[AIRCARBOXY-RXN]]
+
* [[RXN66-169]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxylate}}
+
{{#set: common-name=n'-hydroxymethyl-norcotinine}}
{{#set: inchi-key=inchikey=xfvulmdjzxymsg-ziyngmlesa-k}}
+
{{#set: inchi-key=inchikey=gqufobhepvfqmd-vifpvbqesa-n}}
{{#set: molecular-weight=336.174}}
+
{{#set: molecular-weight=192.217}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-3188

  • common-name:
    • n'-hydroxymethyl-norcotinine
  • smiles:
    • c1(=o)(cc[ch](n(co)1)c2(c=nc=cc=2))
  • inchi-key:
    • gqufobhepvfqmd-vifpvbqesa-n
  • molecular-weight:
    • 192.217

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality